C12H12N4O2S2 — CID 43249743
N'-[2-[(2-amino-1,3-thiazol-5-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 43249743) has the molecular formula C12H12N4O2S2 and a molecular weight of 308.39 g/mol. Its IUPAC name is N'-[2-[(2-amino-1,3-thiazol-5-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | N'-[2-[(2-amino-1,3-thiazol-5-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 43249743 |
| Molecular Formula | C12H12N4O2S2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | N'-[2-[(2-amino-1,3-thiazol-5-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | Nc1ncc(SCC(=O)NNC(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C12H12N4O2S2/c13-12-14-6-10(20-12)19-7-9(17)15-16-11(18)8-4-2-1-3-5-8/h1-6H,7H2,(H2,13,14)(H,15,17)(H,16,18) |
| InChIKey | QHTPFLSRNIFFAB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|