C12H16N2O4S — CID 79682230
N'-[2-(2,3-dihydroxypropylsulfanyl)acetyl]benzohydrazide (PubChem CID 79682230) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is N'-[2-(2,3-dihydroxypropylsulfanyl)acetyl]benzohydrazide.
| Compound Name | N'-[2-(2,3-dihydroxypropylsulfanyl)acetyl]benzohydrazide |
|---|---|
| PubChem CID | 79682230 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | N'-[2-(2,3-dihydroxypropylsulfanyl)acetyl]benzohydrazide |
| SMILES | O=C(CSCC(O)CO)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H16N2O4S/c15-6-10(16)7-19-8-11(17)13-14-12(18)9-4-2-1-3-5-9/h1-5,10,15-16H,6-8H2,(H,13,17)(H,14,18) |
| InChIKey | FQXVASCKRCJSSP-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|