C19H21N3O3S — CID 7969125
2-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-N-(2,4-dimethylphenyl)acetamide (PubChem CID 7969125) has the molecular formula C19H21N3O3S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 7969125 |
| Molecular Formula | C19H21N3O3S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-[2-(2-benzoylhydrazinyl)-2-oxoethyl]sulfanyl-N-(2,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CSCC(=O)NNC(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C19H21N3O3S/c1-13-8-9-16(14(2)10-13)20-17(23)11-26-12-18(24)21-22-19(25)15-6-4-3-5-7-15/h3-10H,11-12H2,1-2H3,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | RFOJUHBAOYZYCN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|