C14H19N3O3S — CID 30905320
2-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-N-(2,4-dimethylphenyl)acetamide (PubChem CID 30905320) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is 2-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-N-(2,4-dimethylphenyl)acetamide.
| Compound Name | 2-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-N-(2,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 30905320 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-[2-(2-acetylhydrazinyl)-2-oxoethyl]sulfanyl-N-(2,4-dimethylphenyl)acetamide |
| SMILES | CC(=O)NNC(=O)CSCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C14H19N3O3S/c1-9-4-5-12(10(2)6-9)15-13(19)7-21-8-14(20)17-16-11(3)18/h4-6H,7-8H2,1-3H3,(H,15,19)(H,16,18)(H,17,20) |
| InChIKey | HOLSRGWANGWBLJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|