C17H19N3O3S2 — CID 7979282
N-(2,4-dimethylphenyl)-2-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]sulfanylacetamide (PubChem CID 7979282) has the molecular formula C17H19N3O3S2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]sulfanylacetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]sulfanylacetamide |
|---|---|
| PubChem CID | 7979282 |
| Molecular Formula | C17H19N3O3S2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl]sulfanylacetamide |
| SMILES | Cc1ccc(NC(=O)CSCC(=O)NNC(=O)c2cccs2)c(C)c1 |
| InChI | InChI=1S/C17H19N3O3S2/c1-11-5-6-13(12(2)8-11)18-15(21)9-24-10-16(22)19-20-17(23)14-4-3-7-25-14/h3-8H,9-10H2,1-2H3,(H,18,21)(H,19,22)(H,20,23) |
| InChIKey | QKSBRPGHVNQNPQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|