C9H13N3O2S2 — CID 43249305
N'-[2-(2-aminoethylsulfanyl)acetyl]thiophene-2-carbohydrazide (PubChem CID 43249305) has the molecular formula C9H13N3O2S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is N'-[2-(2-aminoethylsulfanyl)acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(2-aminoethylsulfanyl)acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 43249305 |
| Molecular Formula | C9H13N3O2S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N'-[2-(2-aminoethylsulfanyl)acetyl]thiophene-2-carbohydrazide |
| SMILES | NCCSCC(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C9H13N3O2S2/c10-3-5-15-6-8(13)11-12-9(14)7-2-1-4-16-7/h1-2,4H,3,5-6,10H2,(H,11,13)(H,12,14) |
| InChIKey | FDFPLUQTSWXKEP-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|