C16H15ClN2O4S2 — CID 2531583
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate (PubChem CID 2531583) has the molecular formula C16H15ClN2O4S2 and a molecular weight of 398.89 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
|---|---|
| PubChem CID | 2531583 |
| Molecular Formula | C16H15ClN2O4S2 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 3-(4-chlorophenyl)sulfanylpropanoate |
| SMILES | O=C(COC(=O)CCSc1ccc(Cl)cc1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C16H15ClN2O4S2/c17-11-3-5-12(6-4-11)24-9-7-15(21)23-10-14(20)18-19-16(22)13-2-1-8-25-13/h1-6,8H,7,9-10H2,(H,18,20)(H,19,22) |
| InChIKey | HDLNVKXCABETQY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|