C18H18N2O4S — CID 2437119
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-phenylsulfanylpropanoate (PubChem CID 2437119) has the molecular formula C18H18N2O4S and a molecular weight of 358.42 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-phenylsulfanylpropanoate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 2437119 |
| Molecular Formula | C18H18N2O4S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 3-phenylsulfanylpropanoate |
| SMILES | O=C(COC(=O)CCSc1ccccc1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O4S/c21-16(19-20-18(23)14-7-3-1-4-8-14)13-24-17(22)11-12-25-15-9-5-2-6-10-15/h1-10H,11-13H2,(H,19,21)(H,20,23) |
| InChIKey | HQQNUEWEZRYKCY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|