C22H25ClN2O4S — CID 27915905
[2-oxo-2-(3-phenylsulfanylpropylamino)ethyl] 4-[(4-chlorobenzoyl)amino]butanoate (PubChem CID 27915905) has the molecular formula C22H25ClN2O4S and a molecular weight of 448.97 g/mol. Its IUPAC name is [2-oxo-2-(3-phenylsulfanylpropylamino)ethyl] 4-[(4-chlorobenzoyl)amino]butanoate.
| Compound Name | [2-oxo-2-(3-phenylsulfanylpropylamino)ethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 27915905 |
| Molecular Formula | C22H25ClN2O4S |
| Molecular Weight | 448.97 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | [2-oxo-2-(3-phenylsulfanylpropylamino)ethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
| SMILES | O=C(COC(=O)CCCNC(=O)c1ccc(Cl)cc1)NCCCSc1ccccc1 |
| InChI | InChI=1S/C22H25ClN2O4S/c23-18-11-9-17(10-12-18)22(28)25-13-4-8-21(27)29-16-20(26)24-14-5-15-30-19-6-2-1-3-7-19/h1-3,6-7,9-12H,4-5,8,13-16H2,(H,24,26)(H,25,28) |
| InChIKey | IAXXFYVGFWMAJY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.97 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|