C20H21ClN2O4 — CID 78762583
[2-(3-methylanilino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate (PubChem CID 78762583) has the molecular formula C20H21ClN2O4 and a molecular weight of 388.85 g/mol. Its IUPAC name is [2-(3-methylanilino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate.
| Compound Name | [2-(3-methylanilino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 78762583 |
| Molecular Formula | C20H21ClN2O4 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | [2-(3-methylanilino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
| SMILES | Cc1cccc(NC(=O)COC(=O)CCCNC(=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C20H21ClN2O4/c1-14-4-2-5-17(12-14)23-18(24)13-27-19(25)6-3-11-22-20(26)15-7-9-16(21)10-8-15/h2,4-5,7-10,12H,3,6,11,13H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | FXJHJUOTFRBCGA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|