C24H28N2O6S2 — CID 16531150
[2-oxo-2-[2-[[2-(3-phenylsulfanylpropanoyloxy)acetyl]amino]ethylamino]ethyl] 3-phenylsulfanylpropanoate (PubChem CID 16531150) has the molecular formula C24H28N2O6S2 and a molecular weight of 504.63 g/mol. Its IUPAC name is [2-oxo-2-[2-[[2-(3-phenylsulfanylpropanoyloxy)acetyl]amino]ethylamino]ethyl] 3-phenylsulfanylpropanoate.
| Compound Name | [2-oxo-2-[2-[[2-(3-phenylsulfanylpropanoyloxy)acetyl]amino]ethylamino]ethyl] 3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 16531150 |
| Molecular Formula | C24H28N2O6S2 |
| Molecular Weight | 504.63 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | [2-oxo-2-[2-[[2-(3-phenylsulfanylpropanoyloxy)acetyl]amino]ethylamino]ethyl] 3-phenylsulfanylpropanoate |
| SMILES | O=C(COC(=O)CCSc1ccccc1)NCCNC(=O)COC(=O)CCSc1ccccc1 |
| InChI | InChI=1S/C24H28N2O6S2/c27-21(17-31-23(29)11-15-33-19-7-3-1-4-8-19)25-13-14-26-22(28)18-32-24(30)12-16-34-20-9-5-2-6-10-20/h1-10H,11-18H2,(H,25,27)(H,26,28) |
| InChIKey | VOKBZEKIIWRVRO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.63 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|