C15H14N2O5S — CID 3876775
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-phenoxyacetate (PubChem CID 3876775) has the molecular formula C15H14N2O5S and a molecular weight of 334.35 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-phenoxyacetate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-phenoxyacetate |
|---|---|
| PubChem CID | 3876775 |
| Molecular Formula | C15H14N2O5S |
| Molecular Weight | 334.35 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-phenoxyacetate |
| SMILES | O=C(COC(=O)COc1ccccc1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C15H14N2O5S/c18-13(16-17-15(20)12-7-4-8-23-12)9-22-14(19)10-21-11-5-2-1-3-6-11/h1-8H,9-10H2,(H,16,18)(H,17,20) |
| InChIKey | NJJWGQUITVADHM-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|