C13H11BrN2O3S — CID 35933556
N'-[2-(3-bromophenoxy)acetyl]thiophene-2-carbohydrazide (PubChem CID 35933556) has the molecular formula C13H11BrN2O3S and a molecular weight of 355.21 g/mol. Its IUPAC name is N'-[2-(3-bromophenoxy)acetyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(3-bromophenoxy)acetyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 35933556 |
| Molecular Formula | C13H11BrN2O3S |
| Molecular Weight | 355.21 g/mol |
| Exact Mass | 353.97 |
| IUPAC Name | N'-[2-(3-bromophenoxy)acetyl]thiophene-2-carbohydrazide |
| SMILES | O=C(COc1cccc(Br)c1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C13H11BrN2O3S/c14-9-3-1-4-10(7-9)19-8-12(17)15-16-13(18)11-5-2-6-20-11/h1-7H,8H2,(H,15,17)(H,16,18) |
| InChIKey | LZPHXWGHVDPODB-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|