C17H15BrN2O5 — CID 7694609
[2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate (PubChem CID 7694609) has the molecular formula C17H15BrN2O5 and a molecular weight of 407.22 g/mol. Its IUPAC name is [2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate.
| Compound Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate |
|---|---|
| PubChem CID | 7694609 |
| Molecular Formula | C17H15BrN2O5 |
| Molecular Weight | 407.22 g/mol |
| Exact Mass | 406.02 |
| IUPAC Name | [2-(2-benzoylhydrazinyl)-2-oxoethyl] 2-(3-bromophenoxy)acetate |
| SMILES | O=C(COC(=O)COc1cccc(Br)c1)NNC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H15BrN2O5/c18-13-7-4-8-14(9-13)24-11-16(22)25-10-15(21)19-20-17(23)12-5-2-1-3-6-12/h1-9H,10-11H2,(H,19,21)(H,20,23) |
| InChIKey | VACZNUAIOTWFGY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|