C15H14BrN3O4S — CID 7601232
N-[2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 7601232) has the molecular formula C15H14BrN3O4S and a molecular weight of 412.27 g/mol. Its IUPAC name is N-[2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 7601232 |
| Molecular Formula | C15H14BrN3O4S |
| Molecular Weight | 412.27 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | N-[2-[2-[2-(4-bromophenoxy)acetyl]hydrazinyl]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cccs1)NNC(=O)COc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H14BrN3O4S/c16-10-3-5-11(6-4-10)23-9-14(21)19-18-13(20)8-17-15(22)12-2-1-7-24-12/h1-7H,8-9H2,(H,17,22)(H,18,20)(H,19,21) |
| InChIKey | SXJLSZOBSSFHDM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|