C13H10BrNO2S — CID 856376
N-[2-(4-bromophenyl)-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 856376) has the molecular formula C13H10BrNO2S and a molecular weight of 324.20 g/mol. Its IUPAC name is N-[2-(4-bromophenyl)-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(4-bromophenyl)-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 856376 |
| Molecular Formula | C13H10BrNO2S |
| Molecular Weight | 324.20 g/mol |
| Exact Mass | 322.96 |
| IUPAC Name | N-[2-(4-bromophenyl)-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cccs1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H10BrNO2S/c14-10-5-3-9(4-6-10)11(16)8-15-13(17)12-2-1-7-18-12/h1-7H,8H2,(H,15,17) |
| InChIKey | CTMPVZRVDXIPCK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.20 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |