C21H17BrN2O3S — CID 31515825
N-[3-[[4-(4-bromophenyl)-4-oxobutanoyl]amino]phenyl]thiophene-2-carboxamide (PubChem CID 31515825) has the molecular formula C21H17BrN2O3S and a molecular weight of 457.35 g/mol. Its IUPAC name is N-[3-[[4-(4-bromophenyl)-4-oxobutanoyl]amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[4-(4-bromophenyl)-4-oxobutanoyl]amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 31515825 |
| Molecular Formula | C21H17BrN2O3S |
| Molecular Weight | 457.35 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | N-[3-[[4-(4-bromophenyl)-4-oxobutanoyl]amino]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(CCC(=O)c1ccc(Br)cc1)Nc1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H17BrN2O3S/c22-15-8-6-14(7-9-15)18(25)10-11-20(26)23-16-3-1-4-17(13-16)24-21(27)19-5-2-12-28-19/h1-9,12-13H,10-11H2,(H,23,26)(H,24,27) |
| InChIKey | HHGZBDULLNCXSG-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.35 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |