C14H11BrN2O5S — CID 25102395
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 5-bromo-2-hydroxybenzoate (PubChem CID 25102395) has the molecular formula C14H11BrN2O5S and a molecular weight of 399.22 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 5-bromo-2-hydroxybenzoate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 5-bromo-2-hydroxybenzoate |
|---|---|
| PubChem CID | 25102395 |
| Molecular Formula | C14H11BrN2O5S |
| Molecular Weight | 399.22 g/mol |
| Exact Mass | 397.96 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 5-bromo-2-hydroxybenzoate |
| SMILES | O=C(COC(=O)c1cc(Br)ccc1O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H11BrN2O5S/c15-8-3-4-10(18)9(6-8)14(21)22-7-12(19)16-17-13(20)11-2-1-5-23-11/h1-6,18H,7H2,(H,16,19)(H,17,20) |
| InChIKey | CLVMYXSYIBLOBY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|