C15H13BrN2O5S — CID 4560871
[2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-bromo-5-methoxybenzoate (PubChem CID 4560871) has the molecular formula C15H13BrN2O5S and a molecular weight of 413.25 g/mol. Its IUPAC name is [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-bromo-5-methoxybenzoate.
| Compound Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-bromo-5-methoxybenzoate |
|---|---|
| PubChem CID | 4560871 |
| Molecular Formula | C15H13BrN2O5S |
| Molecular Weight | 413.25 g/mol |
| Exact Mass | 411.97 |
| IUPAC Name | [2-oxo-2-[2-(thiophene-2-carbonyl)hydrazinyl]ethyl] 2-bromo-5-methoxybenzoate |
| SMILES | COc1ccc(Br)c(C(=O)OCC(=O)NNC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C15H13BrN2O5S/c1-22-9-4-5-11(16)10(7-9)15(21)23-8-13(19)17-18-14(20)12-3-2-6-24-12/h2-7H,8H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | ZQVZKGIKZAWAIT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|