C12H14BrNO5 — CID 7365593
[2-(2-methoxyethylamino)-2-oxoethyl] 5-bromo-2-hydroxybenzoate (PubChem CID 7365593) has the molecular formula C12H14BrNO5 and a molecular weight of 332.15 g/mol. Its IUPAC name is [2-(2-methoxyethylamino)-2-oxoethyl] 5-bromo-2-hydroxybenzoate.
| Compound Name | [2-(2-methoxyethylamino)-2-oxoethyl] 5-bromo-2-hydroxybenzoate |
|---|---|
| PubChem CID | 7365593 |
| Molecular Formula | C12H14BrNO5 |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 331.01 |
| IUPAC Name | [2-(2-methoxyethylamino)-2-oxoethyl] 5-bromo-2-hydroxybenzoate |
| SMILES | COCCNC(=O)COC(=O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C12H14BrNO5/c1-18-5-4-14-11(16)7-19-12(17)9-6-8(13)2-3-10(9)15/h2-3,6,15H,4-5,7H2,1H3,(H,14,16) |
| InChIKey | GRDSTGRBPOJXFG-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|