C13H17BrN2O3 — CID 7149205
[2-(butylamino)-2-oxoethyl] 2-amino-5-bromobenzoate (PubChem CID 7149205) has the molecular formula C13H17BrN2O3 and a molecular weight of 329.19 g/mol. Its IUPAC name is [2-(butylamino)-2-oxoethyl] 2-amino-5-bromobenzoate.
| Compound Name | [2-(butylamino)-2-oxoethyl] 2-amino-5-bromobenzoate |
|---|---|
| PubChem CID | 7149205 |
| Molecular Formula | C13H17BrN2O3 |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | [2-(butylamino)-2-oxoethyl] 2-amino-5-bromobenzoate |
| SMILES | CCCCNC(=O)COC(=O)c1cc(Br)ccc1N |
| InChI | InChI=1S/C13H17BrN2O3/c1-2-3-6-16-12(17)8-19-13(18)10-7-9(14)4-5-11(10)15/h4-5,7H,2-3,6,8,15H2,1H3,(H,16,17) |
| InChIKey | QLGWVYWLDPNXLP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|