C14H14N2O2S2 — CID 9479389
N'-(3-phenylsulfanylpropanoyl)thiophene-2-carbohydrazide (PubChem CID 9479389) has the molecular formula C14H14N2O2S2 and a molecular weight of 306.41 g/mol. Its IUPAC name is N'-(3-phenylsulfanylpropanoyl)thiophene-2-carbohydrazide.
| Compound Name | N'-(3-phenylsulfanylpropanoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 9479389 |
| Molecular Formula | C14H14N2O2S2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | N'-(3-phenylsulfanylpropanoyl)thiophene-2-carbohydrazide |
| SMILES | O=C(CCSc1ccccc1)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C14H14N2O2S2/c17-13(8-10-19-11-5-2-1-3-6-11)15-16-14(18)12-7-4-9-20-12/h1-7,9H,8,10H2,(H,15,17)(H,16,18) |
| InChIKey | WEHWRNBHIPRDBO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|