C23H23N3O3S2 — CID 121062981
N-[2-[[4-(3-phenylsulfanylpropanoylamino)benzoyl]amino]ethyl]thiophene-2-carboxamide (PubChem CID 121062981) has the molecular formula C23H23N3O3S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-[2-[[4-(3-phenylsulfanylpropanoylamino)benzoyl]amino]ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[4-(3-phenylsulfanylpropanoylamino)benzoyl]amino]ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 121062981 |
| Molecular Formula | C23H23N3O3S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[2-[[4-(3-phenylsulfanylpropanoylamino)benzoyl]amino]ethyl]thiophene-2-carboxamide |
| SMILES | O=C(CCSc1ccccc1)Nc1ccc(C(=O)NCCNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C23H23N3O3S2/c27-21(12-16-30-19-5-2-1-3-6-19)26-18-10-8-17(9-11-18)22(28)24-13-14-25-23(29)20-7-4-15-31-20/h1-11,15H,12-14,16H2,(H,24,28)(H,25,29)(H,26,27) |
| InChIKey | AGNWFIWKZFLJND-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|