C15H16N2O4S2 — CID 18191008
N-[3-(4-methylsulfonylanilino)-3-oxopropyl]thiophene-2-carboxamide (PubChem CID 18191008) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-[3-(4-methylsulfonylanilino)-3-oxopropyl]thiophene-2-carboxamide.
| Compound Name | N-[3-(4-methylsulfonylanilino)-3-oxopropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 18191008 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N-[3-(4-methylsulfonylanilino)-3-oxopropyl]thiophene-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(NC(=O)CCNC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C15H16N2O4S2/c1-23(20,21)12-6-4-11(5-7-12)17-14(18)8-9-16-15(19)13-3-2-10-22-13/h2-7,10H,8-9H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | ZBVXNSXCOMBUSW-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |