C15H16N2OS2 — CID 3828723
3-phenylsulfanyl-N-(1-thiophen-2-ylethylideneamino)propanamide (PubChem CID 3828723) has the molecular formula C15H16N2OS2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 3-phenylsulfanyl-N-(1-thiophen-2-ylethylideneamino)propanamide.
| Compound Name | 3-phenylsulfanyl-N-(1-thiophen-2-ylethylideneamino)propanamide |
|---|---|
| PubChem CID | 3828723 |
| Molecular Formula | C15H16N2OS2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-phenylsulfanyl-N-(1-thiophen-2-ylethylideneamino)propanamide |
| SMILES | CC(=NNC(=O)CCSc1ccccc1)c1cccs1 |
| InChI | InChI=1S/C15H16N2OS2/c1-12(14-8-5-10-20-14)16-17-15(18)9-11-19-13-6-3-2-4-7-13/h2-8,10H,9,11H2,1H3,(H,17,18) |
| InChIKey | ATFLUHMYMYADQY-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|