C15H15BrN2O2S2 — CID 4847342
5-bromo-N'-(4-phenylsulfanylbutanoyl)thiophene-2-carbohydrazide (PubChem CID 4847342) has the molecular formula C15H15BrN2O2S2 and a molecular weight of 399.34 g/mol. Its IUPAC name is 5-bromo-N'-(4-phenylsulfanylbutanoyl)thiophene-2-carbohydrazide.
| Compound Name | 5-bromo-N'-(4-phenylsulfanylbutanoyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 4847342 |
| Molecular Formula | C15H15BrN2O2S2 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 397.98 |
| IUPAC Name | 5-bromo-N'-(4-phenylsulfanylbutanoyl)thiophene-2-carbohydrazide |
| SMILES | O=C(CCCSc1ccccc1)NNC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C15H15BrN2O2S2/c16-13-9-8-12(22-13)15(20)18-17-14(19)7-4-10-21-11-5-2-1-3-6-11/h1-3,5-6,8-9H,4,7,10H2,(H,17,19)(H,18,20) |
| InChIKey | XJBDNXFJTWXIJA-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|