C12H15NO3S — CID 43239031
2-(4-phenylsulfanylbutanoylamino)acetic acid (PubChem CID 43239031) has the molecular formula C12H15NO3S and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-(4-phenylsulfanylbutanoylamino)acetic acid.
| Compound Name | 2-(4-phenylsulfanylbutanoylamino)acetic acid |
|---|---|
| PubChem CID | 43239031 |
| Molecular Formula | C12H15NO3S |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | 2-(4-phenylsulfanylbutanoylamino)acetic acid |
| SMILES | O=C(O)CNC(=O)CCCSc1ccccc1 |
| InChI | InChI=1S/C12H15NO3S/c14-11(13-9-12(15)16)7-4-8-17-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2,(H,13,14)(H,15,16) |
| InChIKey | ASZQZOKBUQEQGX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|