C18H20N2O2S — CID 4787769
N'-(2-phenylacetyl)-4-phenylsulfanylbutanehydrazide (PubChem CID 4787769) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N'-(2-phenylacetyl)-4-phenylsulfanylbutanehydrazide.
| Compound Name | N'-(2-phenylacetyl)-4-phenylsulfanylbutanehydrazide |
|---|---|
| PubChem CID | 4787769 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N'-(2-phenylacetyl)-4-phenylsulfanylbutanehydrazide |
| SMILES | O=C(CCCSc1ccccc1)NNC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C18H20N2O2S/c21-17(12-7-13-23-16-10-5-2-6-11-16)19-20-18(22)14-15-8-3-1-4-9-15/h1-6,8-11H,7,12-14H2,(H,19,21)(H,20,22) |
| InChIKey | DAGXHFGVQQIRQB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|