C24H25NO3S2 — CID 86961330
N-[3-(benzylsulfonylmethyl)phenyl]-4-phenylsulfanylbutanamide (PubChem CID 86961330) has the molecular formula C24H25NO3S2 and a molecular weight of 439.60 g/mol. Its IUPAC name is N-[3-(benzylsulfonylmethyl)phenyl]-4-phenylsulfanylbutanamide.
| Compound Name | N-[3-(benzylsulfonylmethyl)phenyl]-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 86961330 |
| Molecular Formula | C24H25NO3S2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | N-[3-(benzylsulfonylmethyl)phenyl]-4-phenylsulfanylbutanamide |
| SMILES | O=C(CCCSc1ccccc1)Nc1cccc(CS(=O)(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C24H25NO3S2/c26-24(15-8-16-29-23-13-5-2-6-14-23)25-22-12-7-11-21(17-22)19-30(27,28)18-20-9-3-1-4-10-20/h1-7,9-14,17H,8,15-16,18-19H2,(H,25,26) |
| InChIKey | BMBGEEOEWORHMV-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|