C22H25N3OS2 — CID 86934519
N-[3-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]phenyl]-4-phenylsulfanylbutanamide (PubChem CID 86934519) has the molecular formula C22H25N3OS2 and a molecular weight of 411.60 g/mol. Its IUPAC name is N-[3-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]phenyl]-4-phenylsulfanylbutanamide.
| Compound Name | N-[3-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]phenyl]-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 86934519 |
| Molecular Formula | C22H25N3OS2 |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | N-[3-[[methyl(1,3-thiazol-4-ylmethyl)amino]methyl]phenyl]-4-phenylsulfanylbutanamide |
| SMILES | CN(Cc1cccc(NC(=O)CCCSc2ccccc2)c1)Cc1cscn1 |
| InChI | InChI=1S/C22H25N3OS2/c1-25(15-20-16-27-17-23-20)14-18-7-5-8-19(13-18)24-22(26)11-6-12-28-21-9-3-2-4-10-21/h2-5,7-10,13,16-17H,6,11-12,14-15H2,1H3,(H,24,26) |
| InChIKey | OFIBHRREEDOFLX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|