C12H17NO2S — CID 60717776
N-ethoxy-4-phenylsulfanylbutanamide (PubChem CID 60717776) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is N-ethoxy-4-phenylsulfanylbutanamide.
| Compound Name | N-ethoxy-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 60717776 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | N-ethoxy-4-phenylsulfanylbutanamide |
| SMILES | CCONC(=O)CCCSc1ccccc1 |
| InChI | InChI=1S/C12H17NO2S/c1-2-15-13-12(14)9-6-10-16-11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10H2,1H3,(H,13,14) |
| InChIKey | FUIFULLVTQUDSY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|