C12H17NOS — CID 13123143
N,N-dimethyl-4-phenylsulfanylbutanamide (PubChem CID 13123143) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is N,N-dimethyl-4-phenylsulfanylbutanamide.
| Compound Name | N,N-dimethyl-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 13123143 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | N,N-dimethyl-4-phenylsulfanylbutanamide |
| SMILES | CN(C)C(=O)CCCSc1ccccc1 |
| InChI | InChI=1S/C12H17NOS/c1-13(2)12(14)9-6-10-15-11-7-4-3-5-8-11/h3-5,7-8H,6,9-10H2,1-2H3 |
| InChIKey | ZVMSQBLBXSQMKX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|