C13H17NO2S — CID 66355142
4-(3-formylphenyl)sulfanyl-N,N-dimethylbutanamide (PubChem CID 66355142) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 4-(3-formylphenyl)sulfanyl-N,N-dimethylbutanamide.
| Compound Name | 4-(3-formylphenyl)sulfanyl-N,N-dimethylbutanamide |
|---|---|
| PubChem CID | 66355142 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 4-(3-formylphenyl)sulfanyl-N,N-dimethylbutanamide |
| SMILES | CN(C)C(=O)CCCSc1cccc(C=O)c1 |
| InChI | InChI=1S/C13H17NO2S/c1-14(2)13(16)7-4-8-17-12-6-3-5-11(9-12)10-15/h3,5-6,9-10H,4,7-8H2,1-2H3 |
| InChIKey | FPRVSGSMBKDKMR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|