C15H19NO2 — CID 138465597
(Z)-6-(3-formylphenyl)-N,N-dimethylhex-5-enamide (PubChem CID 138465597) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (Z)-6-(3-formylphenyl)-N,N-dimethylhex-5-enamide.
| Compound Name | (Z)-6-(3-formylphenyl)-N,N-dimethylhex-5-enamide |
|---|---|
| PubChem CID | 138465597 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (Z)-6-(3-formylphenyl)-N,N-dimethylhex-5-enamide |
| SMILES | CN(C)C(=O)CCC/C=C\c1cccc(C=O)c1 |
| InChI | InChI=1S/C15H19NO2/c1-16(2)15(18)10-5-3-4-7-13-8-6-9-14(11-13)12-17/h4,6-9,11-12H,3,5,10H2,1-2H3/b7-4- |
| InChIKey | FHJPMHJBUDQBIB-DAXSKMNVSA-N |
| XLogP | 2.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|