C22H32N2O4 — CID 163699083
(3R)-4-[[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]amino]-2,3-dimethylpentanoic acid (PubChem CID 163699083) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is (3R)-4-[[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]amino]-2,3-dimethylpentanoic acid.
| Compound Name | (3R)-4-[[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]amino]-2,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 163699083 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (3R)-4-[[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]amino]-2,3-dimethylpentanoic acid |
| SMILES | CC(NC(=O)c1cccc(/C=C\CCCC(=O)N(C)C)c1)[C@H](C)C(C)C(=O)O |
| InChI | InChI=1S/C22H32N2O4/c1-15(16(2)22(27)28)17(3)23-21(26)19-12-9-11-18(14-19)10-7-6-8-13-20(25)24(4)5/h7,9-12,14-17H,6,8,13H2,1-5H3,(H,23,26)(H,27,28)/b10-7-/t15-,16?,17?/m1/s1 |
| InChIKey | JZKXOZNBAYCHEE-QKPCCCMJSA-N |
| XLogP | 3.43 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|