C25H32N2O4S — CID 159055719
methyl (2S)-2-[[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]amino]-3-phenylpropanoate;sulfane (PubChem CID 159055719) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]amino]-3-phenylpropanoate;sulfane.
| Compound Name | methyl (2S)-2-[[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]amino]-3-phenylpropanoate;sulfane |
|---|---|
| PubChem CID | 159055719 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | methyl (2S)-2-[[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]amino]-3-phenylpropanoate;sulfane |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)c1cccc(/C=C\CCCC(=O)N(C)C)c1.S |
| InChI | InChI=1S/C25H30N2O4.H2S/c1-27(2)23(28)16-9-5-8-11-19-14-10-15-21(17-19)24(29)26-22(25(30)31-3)18-20-12-6-4-7-13-20;/h4,6-8,10-15,17,22H,5,9,16,18H2,1-3H3,(H,26,29);1H2/b11-8-;/t22-;/m0./s1 |
| InChIKey | JXVIMZNQCOQHSB-PDQYNFCZSA-N |
| XLogP | 3.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|