C20H27NO4 — CID 138465428
(2R)-5-[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]phenyl]-2-methyl-5-oxopentanoic acid (PubChem CID 138465428) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (2R)-5-[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]phenyl]-2-methyl-5-oxopentanoic acid.
| Compound Name | (2R)-5-[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]phenyl]-2-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 138465428 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (2R)-5-[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]phenyl]-2-methyl-5-oxopentanoic acid |
| SMILES | C[C@H](CCC(=O)c1cccc(/C=C\CCCC(=O)N(C)C)c1)C(=O)O |
| InChI | InChI=1S/C20H27NO4/c1-15(20(24)25)12-13-18(22)17-10-7-9-16(14-17)8-5-4-6-11-19(23)21(2)3/h5,7-10,14-15H,4,6,11-13H2,1-3H3,(H,24,25)/b8-5-/t15-/m1/s1 |
| InChIKey | WVVZGDZDYGMILF-GTBONMDNSA-N |
| XLogP | 3.64 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|