C19H23NO3 — CID 138465398
methyl (2S)-5-[3-[(Z)-5-cyanopent-1-enyl]phenyl]-2-methyl-5-oxopentanoate (PubChem CID 138465398) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is methyl (2S)-5-[3-[(Z)-5-cyanopent-1-enyl]phenyl]-2-methyl-5-oxopentanoate.
| Compound Name | methyl (2S)-5-[3-[(Z)-5-cyanopent-1-enyl]phenyl]-2-methyl-5-oxopentanoate |
|---|---|
| PubChem CID | 138465398 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | methyl (2S)-5-[3-[(Z)-5-cyanopent-1-enyl]phenyl]-2-methyl-5-oxopentanoate |
| SMILES | COC(=O)[C@@H](C)CCC(=O)c1cccc(/C=C\CCCC#N)c1 |
| InChI | InChI=1S/C19H23NO3/c1-15(19(22)23-2)11-12-18(21)17-10-7-9-16(14-17)8-5-3-4-6-13-20/h5,7-10,14-15H,3-4,6,11-12H2,1-2H3/b8-5-/t15-/m0/s1 |
| InChIKey | RYIWHCFROCUWIZ-KKTNHOPESA-N |
| XLogP | 4.17 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|