C22H25NO4 — CID 138465545
(2S)-2-methyl-5-oxo-5-[3-[(Z)-5-(2-oxo-1-pyridinyl)pent-1-enyl]phenyl]pentanoic acid (PubChem CID 138465545) has the molecular formula C22H25NO4 and a molecular weight of 367.44 g/mol. Its IUPAC name is (2S)-2-methyl-5-oxo-5-[3-[(Z)-5-(2-oxo-1-pyridinyl)pent-1-enyl]phenyl]pentanoic acid.
| Compound Name | (2S)-2-methyl-5-oxo-5-[3-[(Z)-5-(2-oxo-1-pyridinyl)pent-1-enyl]phenyl]pentanoic acid |
|---|---|
| PubChem CID | 138465545 |
| Molecular Formula | C22H25NO4 |
| Molecular Weight | 367.44 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | (2S)-2-methyl-5-oxo-5-[3-[(Z)-5-(2-oxo-1-pyridinyl)pent-1-enyl]phenyl]pentanoic acid |
| SMILES | C[C@@H](CCC(=O)c1cccc(/C=C\CCCn2ccccc2=O)c1)C(=O)O |
| InChI | InChI=1S/C22H25NO4/c1-17(22(26)27)12-13-20(24)19-10-7-9-18(16-19)8-3-2-5-14-23-15-6-4-11-21(23)25/h3-4,6-11,15-17H,2,5,12-14H2,1H3,(H,26,27)/b8-3-/t17-/m0/s1 |
| InChIKey | YPBMKWRLEOKISS-VCKUIECUSA-N |
| XLogP | 4.03 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.44 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|