C15H22N2O4S — CID 82031433
4-methylsulfanyl-2-[5-(2-oxo-1-pyridinyl)pentanoylamino]butanoic acid (PubChem CID 82031433) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-methylsulfanyl-2-[5-(2-oxo-1-pyridinyl)pentanoylamino]butanoic acid.
| Compound Name | 4-methylsulfanyl-2-[5-(2-oxo-1-pyridinyl)pentanoylamino]butanoic acid |
|---|---|
| PubChem CID | 82031433 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-methylsulfanyl-2-[5-(2-oxo-1-pyridinyl)pentanoylamino]butanoic acid |
| SMILES | CSCCC(NC(=O)CCCCn1ccccc1=O)C(=O)O |
| InChI | InChI=1S/C15H22N2O4S/c1-22-11-8-12(15(20)21)16-13(18)6-2-4-9-17-10-5-3-7-14(17)19/h3,5,7,10,12H,2,4,6,8-9,11H2,1H3,(H,16,18)(H,20,21) |
| InChIKey | JJBRSRMDMQBGHG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|