C24H26N2O4 — CID 134469981
2-[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]imino-3-phenylpropanoic acid (PubChem CID 134469981) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is 2-[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]imino-3-phenylpropanoic acid.
| Compound Name | 2-[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]imino-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 134469981 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[3-[(Z)-6-(dimethylamino)-6-oxohex-1-enyl]benzoyl]imino-3-phenylpropanoic acid |
| SMILES | CN(C)C(=O)CCC/C=C\c1cccc(C(=O)/N=C(/Cc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C24H26N2O4/c1-26(2)22(27)15-8-4-7-10-18-13-9-14-20(16-18)23(28)25-21(24(29)30)17-19-11-5-3-6-12-19/h3,5-7,9-14,16H,4,8,15,17H2,1-2H3,(H,29,30)/b10-7-,25-21- |
| InChIKey | JVPOZHOTBVEKRD-IJVIVVAJSA-N |
| XLogP | 3.87 |
| TPSA | 87.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|