C16H23NO2S — CID 102684582
N-cyclobutyl-N-(2-hydroxyethyl)-4-phenylsulfanylbutanamide (PubChem CID 102684582) has the molecular formula C16H23NO2S and a molecular weight of 293.43 g/mol. Its IUPAC name is N-cyclobutyl-N-(2-hydroxyethyl)-4-phenylsulfanylbutanamide.
| Compound Name | N-cyclobutyl-N-(2-hydroxyethyl)-4-phenylsulfanylbutanamide |
|---|---|
| PubChem CID | 102684582 |
| Molecular Formula | C16H23NO2S |
| Molecular Weight | 293.43 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | N-cyclobutyl-N-(2-hydroxyethyl)-4-phenylsulfanylbutanamide |
| SMILES | O=C(CCCSc1ccccc1)N(CCO)C1CCC1 |
| InChI | InChI=1S/C16H23NO2S/c18-12-11-17(14-6-4-7-14)16(19)10-5-13-20-15-8-2-1-3-9-15/h1-3,8-9,14,18H,4-7,10-13H2 |
| InChIKey | GLOGYBVZXFWUOH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|