C16H22ClNO2S — CID 102866178
3-(2-chlorophenyl)sulfanyl-N-cyclobutyl-N-(3-hydroxypropyl)propanamide (PubChem CID 102866178) has the molecular formula C16H22ClNO2S and a molecular weight of 327.88 g/mol. Its IUPAC name is 3-(2-chlorophenyl)sulfanyl-N-cyclobutyl-N-(3-hydroxypropyl)propanamide.
| Compound Name | 3-(2-chlorophenyl)sulfanyl-N-cyclobutyl-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 102866178 |
| Molecular Formula | C16H22ClNO2S |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 3-(2-chlorophenyl)sulfanyl-N-cyclobutyl-N-(3-hydroxypropyl)propanamide |
| SMILES | O=C(CCSc1ccccc1Cl)N(CCCO)C1CCC1 |
| InChI | InChI=1S/C16H22ClNO2S/c17-14-7-1-2-8-15(14)21-12-9-16(20)18(10-4-11-19)13-5-3-6-13/h1-2,7-8,13,19H,3-6,9-12H2 |
| InChIKey | PBXJGCVNACPNGE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |