C16H22ClNO3 — CID 102866620
2-(2-chlorophenoxy)-N-cyclobutyl-N-(3-hydroxypropyl)propanamide (PubChem CID 102866620) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-cyclobutyl-N-(3-hydroxypropyl)propanamide.
| Compound Name | 2-(2-chlorophenoxy)-N-cyclobutyl-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 102866620 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-cyclobutyl-N-(3-hydroxypropyl)propanamide |
| SMILES | CC(Oc1ccccc1Cl)C(=O)N(CCCO)C1CCC1 |
| InChI | InChI=1S/C16H22ClNO3/c1-12(21-15-9-3-2-8-14(15)17)16(20)18(10-5-11-19)13-6-4-7-13/h2-3,8-9,12-13,19H,4-7,10-11H2,1H3 |
| InChIKey | XGVSRUOKEVWCFZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |