C15H19Cl2NO3 — CID 102684163
N-cyclobutyl-2-(2,4-dichlorophenoxy)-N-(2-hydroxyethyl)propanamide (PubChem CID 102684163) has the molecular formula C15H19Cl2NO3 and a molecular weight of 332.23 g/mol. Its IUPAC name is N-cyclobutyl-2-(2,4-dichlorophenoxy)-N-(2-hydroxyethyl)propanamide.
| Compound Name | N-cyclobutyl-2-(2,4-dichlorophenoxy)-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 102684163 |
| Molecular Formula | C15H19Cl2NO3 |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-cyclobutyl-2-(2,4-dichlorophenoxy)-N-(2-hydroxyethyl)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)N(CCO)C1CCC1 |
| InChI | InChI=1S/C15H19Cl2NO3/c1-10(21-14-6-5-11(16)9-13(14)17)15(20)18(7-8-19)12-3-2-4-12/h5-6,9-10,12,19H,2-4,7-8H2,1H3 |
| InChIKey | IFFQYHQVEVMQSI-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |