C14H19Cl2NO3 — CID 115771866
2-(2,4-dichlorophenoxy)-N-ethyl-N-(3-hydroxypropyl)propanamide (PubChem CID 115771866) has the molecular formula C14H19Cl2NO3 and a molecular weight of 320.22 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-ethyl-N-(3-hydroxypropyl)propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-ethyl-N-(3-hydroxypropyl)propanamide |
|---|---|
| PubChem CID | 115771866 |
| Molecular Formula | C14H19Cl2NO3 |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-ethyl-N-(3-hydroxypropyl)propanamide |
| SMILES | CCN(CCCO)C(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H19Cl2NO3/c1-3-17(7-4-8-18)14(19)10(2)20-13-6-5-11(15)9-12(13)16/h5-6,9-10,18H,3-4,7-8H2,1-2H3 |
| InChIKey | RMAHOZSNGYWVGL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |