C17H25Cl2NO2 — CID 4155805
N,N-dibutyl-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 4155805) has the molecular formula C17H25Cl2NO2 and a molecular weight of 346.30 g/mol. Its IUPAC name is N,N-dibutyl-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N,N-dibutyl-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 4155805 |
| Molecular Formula | C17H25Cl2NO2 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N,N-dibutyl-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | CCCCN(CCCC)C(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H25Cl2NO2/c1-4-6-10-20(11-7-5-2)17(21)13(3)22-16-9-8-14(18)12-15(16)19/h8-9,12-13H,4-7,10-11H2,1-3H3 |
| InChIKey | SGYFAFIWSCPDQY-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |