C15H20Cl2O4 — CID 76970477
2-butoxyethyl (2S)-2-(2,4-dichlorophenoxy)propanoate (PubChem CID 76970477) has the molecular formula C15H20Cl2O4 and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-butoxyethyl (2S)-2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | 2-butoxyethyl (2S)-2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 76970477 |
| Molecular Formula | C15H20Cl2O4 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-butoxyethyl (2S)-2-(2,4-dichlorophenoxy)propanoate |
| SMILES | CCCCOCCOC(=O)[C@H](C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2O4/c1-3-4-7-19-8-9-20-15(18)11(2)21-14-6-5-12(16)10-13(14)17/h5-6,10-11H,3-4,7-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | NCMJQZVNCFTQPG-NSHDSACASA-N |
| XLogP | 4.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|