C15H21Cl2NO4 — CID 70624483
2-butoxyethyl 2-[(3,5-dichloro-6-methyl-2-pyridinyl)oxy]propanoate (PubChem CID 70624483) has the molecular formula C15H21Cl2NO4 and a molecular weight of 350.24 g/mol. Its IUPAC name is 2-butoxyethyl 2-[(3,5-dichloro-6-methyl-2-pyridinyl)oxy]propanoate.
| Compound Name | 2-butoxyethyl 2-[(3,5-dichloro-6-methyl-2-pyridinyl)oxy]propanoate |
|---|---|
| PubChem CID | 70624483 |
| Molecular Formula | C15H21Cl2NO4 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 349.08 |
| IUPAC Name | 2-butoxyethyl 2-[(3,5-dichloro-6-methyl-2-pyridinyl)oxy]propanoate |
| SMILES | CCCCOCCOC(=O)C(C)Oc1nc(C)c(Cl)cc1Cl |
| InChI | InChI=1S/C15H21Cl2NO4/c1-4-5-6-20-7-8-21-15(19)11(3)22-14-13(17)9-12(16)10(2)18-14/h9,11H,4-8H2,1-3H3 |
| InChIKey | SZQUIHHCSGGYMX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|