C18H19Cl2NO5 — CID 7716442
2-ethoxyethyl (2S)-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]propanoate (PubChem CID 7716442) has the molecular formula C18H19Cl2NO5 and a molecular weight of 400.26 g/mol. Its IUPAC name is 2-ethoxyethyl (2S)-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]propanoate.
| Compound Name | 2-ethoxyethyl (2S)-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
|---|---|
| PubChem CID | 7716442 |
| Molecular Formula | C18H19Cl2NO5 |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | 2-ethoxyethyl (2S)-2-[4-[(3,6-dichloro-2-pyridinyl)oxy]phenoxy]propanoate |
| SMILES | CCOCCOC(=O)[C@H](C)Oc1ccc(Oc2nc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2NO5/c1-3-23-10-11-24-18(22)12(2)25-13-4-6-14(7-5-13)26-17-15(19)8-9-16(20)21-17/h4-9,12H,3,10-11H2,1-2H3/t12-/m0/s1 |
| InChIKey | PCKCITKNINPHLL-LBPRGKRZSA-N |
| XLogP | 4.53 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|